C7H3F5O — CID 157226759
formaldehyde;1,2,3,4,5-pentafluorobenzene (PubChem CID 157226759) has the molecular formula C7H3F5O and a molecular weight of 198.09 g/mol. Its IUPAC name is formaldehyde;1,2,3,4,5-pentafluorobenzene.
| Compound Name | formaldehyde;1,2,3,4,5-pentafluorobenzene |
|---|---|
| PubChem CID | 157226759 |
| Molecular Formula | C7H3F5O |
| Molecular Weight | 198.09 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | formaldehyde;1,2,3,4,5-pentafluorobenzene |
| SMILES | C=O.Fc1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6HF5.CH2O/c7-2-1-3(8)5(10)6(11)4(2)9;1-2/h1H;1H2 |
| InChIKey | ATPXYBRJAYQHIJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.09 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|