C8H16N2O — CID 157227822
2-hydroxy-6-propan-2-yl-2,6-diazaspiro[3.3]heptane (PubChem CID 157227822) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-hydroxy-6-propan-2-yl-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-hydroxy-6-propan-2-yl-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 157227822 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-hydroxy-6-propan-2-yl-2,6-diazaspiro[3.3]heptane |
| SMILES | CC(C)N1CC2(CN(O)C2)C1 |
| InChI | InChI=1S/C8H16N2O/c1-7(2)9-3-8(4-9)5-10(11)6-8/h7,11H,3-6H2,1-2H3 |
| InChIKey | VQQWOQMAYAWJKP-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |