C22H29Cl2FN4O3 — CID 157227935
3-(2-chloroethyl)-9-fluoro-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;3-(2-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 157227935) has the molecular formula C22H29Cl2FN4O3 and a molecular weight of 487.40 g/mol. Its IUPAC name is 3-(2-chloroethyl)-9-fluoro-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;3-(2-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(2-chloroethyl)-9-fluoro-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;3-(2-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 157227935 |
| Molecular Formula | C22H29Cl2FN4O3 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 3-(2-chloroethyl)-9-fluoro-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one;3-(2-chloroethyl)-9-hydroxy-2-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1nc2n(c(=O)c1CCCl)CCCC2F.Cc1nc2n(c(=O)c1CCCl)CCCC2O |
| InChI | InChI=1S/C11H14ClFN2O.C11H15ClN2O2/c1-7-8(4-5-12)11(16)15-6-2-3-9(13)10(15)14-7;1-7-8(4-5-12)11(16)14-6-2-3-9(15)10(14)13-7/h9H,2-6H2,1H3;9,15H,2-6H2,1H3 |
| InChIKey | ATTKVBLTSHWMEK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|