C26H50N6O4 — CID 157228281
tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-azidopropyl)piperidine-1-carboxylate (PubChem CID 157228281) has the molecular formula C26H50N6O4 and a molecular weight of 510.72 g/mol. Its IUPAC name is tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-azidopropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-azidopropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 157228281 |
| Molecular Formula | C26H50N6O4 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.39 |
| IUPAC Name | tert-butyl 4-(3-aminopropyl)piperidine-1-carboxylate;tert-butyl 4-(3-azidopropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCN)CC1.CC(C)(C)OC(=O)N1CCC(CCCN=[N+]=[N-])CC1 |
| InChI | InChI=1S/C13H24N4O2.C13H26N2O2/c1-13(2,3)19-12(18)17-9-6-11(7-10-17)5-4-8-15-16-14;1-13(2,3)17-12(16)15-9-6-11(7-10-15)5-4-8-14/h11H,4-10H2,1-3H3;11H,4-10,14H2,1-3H3 |
| InChIKey | ATUOXLBFCDFTPK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|