About N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine
N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine (PubChem CID 157228424) has the molecular formula C17H15Cl2F2NO
and a molecular weight of 358.22 g/mol. Its IUPAC name is N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine |
| PubChem CID | 157228424 |
| Molecular Formula | C17H15Cl2F2NO |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine |
| SMILES | ON=C(C(CF)c1ccc(Cl)cc1)C(CF)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2F2NO/c18-13-5-1-11(2-6-13)15(9-20)17(22-23)16(10-21)12-3-7-14(19)8-4-12/h1-8,15-16,23H,9-10H2 |
| InChIKey | CCBNLYLPFOWECN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine?
The IUPAC name of N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine (CID 157228424) is N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine.
What is the SMILES notation for N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine?
The canonical SMILES for N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine is ON=C(C(CF)c1ccc(Cl)cc1)C(CF)c1ccc(Cl)cc1.
What is the InChIKey of N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine?
The InChIKey is CCBNLYLPFOWECN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2F2NO/c18-13-5-1-11(2-6-13)15(9-20)17(22-23)16(10-21)12-3-7-14(19)8-4-12/h1-8,15-16,23H,9-10H2.
What are the key properties of N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine?
N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine has a molecular weight of 358.22 g/mol, XLogP of 5.63, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,4-bis(4-chlorophenyl)-1,5-difluoropentan-3-ylidene]hydroxylamine is sourced from PubChem (CID 157228424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).