C26H30I3NO11 — CID 157228746
[2-acetyloxy-5-[3-(4,5-diacetyloxypentanoyl)-5-(2-hydroxyethylideneamino)-2,4,6-triiodophenyl]-5-oxopentyl] acetate (PubChem CID 157228746) has the molecular formula C26H30I3NO11 and a molecular weight of 913.23 g/mol. Its IUPAC name is [2-acetyloxy-5-[3-(4,5-diacetyloxypentanoyl)-5-(2-hydroxyethylideneamino)-2,4,6-triiodophenyl]-5-oxopentyl] acetate.
| Compound Name | [2-acetyloxy-5-[3-(4,5-diacetyloxypentanoyl)-5-(2-hydroxyethylideneamino)-2,4,6-triiodophenyl]-5-oxopentyl] acetate |
|---|---|
| PubChem CID | 157228746 |
| Molecular Formula | C26H30I3NO11 |
| Molecular Weight | 913.23 g/mol |
| Exact Mass | 912.90 |
| IUPAC Name | [2-acetyloxy-5-[3-(4,5-diacetyloxypentanoyl)-5-(2-hydroxyethylideneamino)-2,4,6-triiodophenyl]-5-oxopentyl] acetate |
| SMILES | CC(=O)OCC(CCC(=O)c1c(I)c(/N=C/CO)c(I)c(C(=O)CCC(COC(C)=O)OC(C)=O)c1I)OC(C)=O |
| InChI | InChI=1S/C26H30I3NO11/c1-13(32)38-11-17(40-15(3)34)5-7-19(36)21-23(27)22(25(29)26(24(21)28)30-9-10-31)20(37)8-6-18(41-16(4)35)12-39-14(2)33/h9,17-18,31H,5-8,10-12H2,1-4H3/b30-9+ |
| InChIKey | ISVVIZKGRADWAY-OOEWDAAOSA-N |
| XLogP | 4.11 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|