C32H37NO10 — CID 15722882
(34-nitro-9,12,15,18,21,24-hexaoxatetracyclo[30.3.1.03,8.025,30]hexatriaconta-1(35),3,5,7,25,27,29,32(36),33-nonaen-36-yl) acetate (PubChem CID 15722882) has the molecular formula C32H37NO10 and a molecular weight of 595.64 g/mol. Its IUPAC name is (34-nitro-9,12,15,18,21,24-hexaoxatetracyclo[30.3.1.03,8.025,30]hexatriaconta-1(35),3,5,7,25,27,29,32(36),33-nonaen-36-yl) acetate.
| Compound Name | (34-nitro-9,12,15,18,21,24-hexaoxatetracyclo[30.3.1.03,8.025,30]hexatriaconta-1(35),3,5,7,25,27,29,32(36),33-nonaen-36-yl) acetate |
|---|---|
| PubChem CID | 15722882 |
| Molecular Formula | C32H37NO10 |
| Molecular Weight | 595.64 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (34-nitro-9,12,15,18,21,24-hexaoxatetracyclo[30.3.1.03,8.025,30]hexatriaconta-1(35),3,5,7,25,27,29,32(36),33-nonaen-36-yl) acetate |
| SMILES | CC(=O)Oc1c2cc([N+](=O)[O-])cc1Cc1ccccc1OCCOCCOCCOCCOCCOc1ccccc1C2 |
| InChI | InChI=1S/C32H37NO10/c1-24(34)43-32-27-20-25-6-2-4-8-30(25)41-18-16-39-14-12-37-10-11-38-13-15-40-17-19-42-31-9-5-3-7-26(31)21-28(32)23-29(22-27)33(35)36/h2-9,22-23H,10-21H2,1H3 |
| InChIKey | HLFSREWQYRMQFZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 124.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|