C15H21NO4 — CID 157229894
carbon dioxide;N-(3-hydroxypropyl)-3-(2-methylpropyl)benzamide (PubChem CID 157229894) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is carbon dioxide;N-(3-hydroxypropyl)-3-(2-methylpropyl)benzamide.
| Compound Name | carbon dioxide;N-(3-hydroxypropyl)-3-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 157229894 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | carbon dioxide;N-(3-hydroxypropyl)-3-(2-methylpropyl)benzamide |
| SMILES | CC(C)Cc1cccc(C(=O)NCCCO)c1.O=C=O |
| InChI | InChI=1S/C14H21NO2.CO2/c1-11(2)9-12-5-3-6-13(10-12)14(17)15-7-4-8-16;2-1-3/h3,5-6,10-11,16H,4,7-9H2,1-2H3,(H,15,17); |
| InChIKey | ATZCFUPYJBYIKD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|