C12H18F3N3O6 — CID 157230065
(2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 157230065) has the molecular formula C12H18F3N3O6 and a molecular weight of 357.29 g/mol. Its IUPAC name is (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 157230065 |
| Molecular Formula | C12H18F3N3O6 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (2S)-6-amino-2-[(2,2,2-trifluoroacetyl)amino]hexanoic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | NCCCC[C@H](NC(=O)C(F)(F)F)C(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C8H13F3N2O3.C4H5NO3/c9-8(10,11)7(16)13-5(6(14)15)3-1-2-4-12;6-3-1-2-4(7)5(3)8/h5H,1-4,12H2,(H,13,16)(H,14,15);8H,1-2H2/t5-;/m0./s1 |
| InChIKey | ATZPQYJLXULAFM-JEDNCBNOSA-N |
| XLogP | -0.23 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|