C21H24O2 — CID 157230569
(1S,1'S)-1,1'-diethyl-4,4'-dimethyl-3,3'-spirobi[1H-2-benzofuran] (PubChem CID 157230569) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is (1S,1'S)-1,1'-diethyl-4,4'-dimethyl-3,3'-spirobi[1H-2-benzofuran].
| Compound Name | (1S,1'S)-1,1'-diethyl-4,4'-dimethyl-3,3'-spirobi[1H-2-benzofuran] |
|---|---|
| PubChem CID | 157230569 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (1S,1'S)-1,1'-diethyl-4,4'-dimethyl-3,3'-spirobi[1H-2-benzofuran] |
| SMILES | CC[C@@H]1OC2(O[C@@H](CC)c3cccc(C)c32)c2c(C)cccc21 |
| InChI | InChI=1S/C21H24O2/c1-5-17-15-11-7-9-13(3)19(15)21(22-17)20-14(4)10-8-12-16(20)18(6-2)23-21/h7-12,17-18H,5-6H2,1-4H3/t17-,18-,21?/m0/s1 |
| InChIKey | AUAZQOKMIHRMTH-GAOSQQNJSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |