C22H17ClF2N4O2 — CID 157230607
N-(5-chloro-2-pyridinyl)-4,5-difluoro-2-[2-[4-(N'-methylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide (PubChem CID 157230607) has the molecular formula C22H17ClF2N4O2 and a molecular weight of 442.85 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-4,5-difluoro-2-[2-[4-(N'-methylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-4,5-difluoro-2-[2-[4-(N'-methylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 157230607 |
| Molecular Formula | C22H17ClF2N4O2 |
| Molecular Weight | 442.85 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-4,5-difluoro-2-[2-[4-(N'-methylcarbamimidoyl)phenyl]-2-oxoethyl]benzamide |
| SMILES | C/N=C(\N)c1ccc(C(=O)Cc2cc(F)c(F)cc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C22H17ClF2N4O2/c1-27-21(26)13-4-2-12(3-5-13)19(30)9-14-8-17(24)18(25)10-16(14)22(31)29-20-7-6-15(23)11-28-20/h2-8,10-11H,9H2,1H3,(H2,26,27)(H,28,29,31) |
| InChIKey | MHPNELWBRSRERB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.85 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|