C23H19ClF2N4O2 — CID 157230608
N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]-4,5-difluorobenzamide (PubChem CID 157230608) has the molecular formula C23H19ClF2N4O2 and a molecular weight of 456.88 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]-4,5-difluorobenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 157230608 |
| Molecular Formula | C23H19ClF2N4O2 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-2-oxoethyl]-4,5-difluorobenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2cc(F)c(F)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N(C)C |
| InChI | InChI=1S/C23H19ClF2N4O2/c1-30(2)22(27)14-5-3-13(4-6-14)20(31)10-15-9-18(25)19(26)11-17(15)23(32)29-21-8-7-16(24)12-28-21/h3-9,11-12,27H,10H2,1-2H3,(H,28,29,32)/b27-22- |
| InChIKey | ZQHGXCVNOZEBLU-QYQHSDTDSA-N |
| XLogP | 4.58 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|