About 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol
4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol (PubChem CID 157230698) has the molecular formula C14H9Br2F6NO
and a molecular weight of 481.03 g/mol. Its IUPAC name is 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol.
Molecular Properties
| Compound Name | 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol |
| PubChem CID | 157230698 |
| Molecular Formula | C14H9Br2F6NO |
| Molecular Weight | 481.03 g/mol |
| Exact Mass | 478.90 |
| IUPAC Name | 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol |
| SMILES | Nc1ccc(Br)c(C(F)(F)F)c1.Oc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H5BrF3N.C7H4BrF3O/c2*8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3H,12H2;1-3,12H |
| InChIKey | AUBIGGNFZRMBJK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.03 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol?
The IUPAC name of 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol (CID 157230698) is 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol.
What is the SMILES notation for 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol?
The canonical SMILES for 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol is Nc1ccc(Br)c(C(F)(F)F)c1.Oc1ccc(Br)c(C(F)(F)F)c1.
What is the InChIKey of 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol?
The InChIKey is AUBIGGNFZRMBJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrF3N.C7H4BrF3O/c2*8-6-2-1-4(12)3-5(6)7(9,10)11/h1-3H,12H2;1-3,12H.
What are the key properties of 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol?
4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol has a molecular weight of 481.03 g/mol, XLogP of 6.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-(trifluoromethyl)aniline;4-bromo-3-(trifluoromethyl)phenol is sourced from PubChem (CID 157230698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).