C17H14Cl3N3O2 — CID 157231749
6-(5-azaspiro[2.3]hexan-5-yl)-2-chloropyridine-3-carbaldehyde;2,6-dichloropyridine-3-carbaldehyde (PubChem CID 157231749) has the molecular formula C17H14Cl3N3O2 and a molecular weight of 398.68 g/mol. Its IUPAC name is 6-(5-azaspiro[2.3]hexan-5-yl)-2-chloropyridine-3-carbaldehyde;2,6-dichloropyridine-3-carbaldehyde.
| Compound Name | 6-(5-azaspiro[2.3]hexan-5-yl)-2-chloropyridine-3-carbaldehyde;2,6-dichloropyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 157231749 |
| Molecular Formula | C17H14Cl3N3O2 |
| Molecular Weight | 398.68 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 6-(5-azaspiro[2.3]hexan-5-yl)-2-chloropyridine-3-carbaldehyde;2,6-dichloropyridine-3-carbaldehyde |
| SMILES | O=Cc1ccc(Cl)nc1Cl.O=Cc1ccc(N2CC3(CC3)C2)nc1Cl |
| InChI | InChI=1S/C11H11ClN2O.C6H3Cl2NO/c12-10-8(5-15)1-2-9(13-10)14-6-11(7-14)3-4-11;7-5-2-1-4(3-10)6(8)9-5/h1-2,5H,3-4,6-7H2;1-3H |
| InChIKey | AUENNHZMILEHNJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.68 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|