C36H50B2F2N2O7 — CID 157231868
tert-butyl 5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate;5-fluoro-1H-indole;4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane (PubChem CID 157231868) has the molecular formula C36H50B2F2N2O7 and a molecular weight of 682.42 g/mol. Its IUPAC name is tert-butyl 5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate;5-fluoro-1H-indole;4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane.
| Compound Name | tert-butyl 5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate;5-fluoro-1H-indole;4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 157231868 |
| Molecular Formula | C36H50B2F2N2O7 |
| Molecular Weight | 682.42 g/mol |
| Exact Mass | 682.38 |
| IUPAC Name | tert-butyl 5-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate;5-fluoro-1H-indole;4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane |
| SMILES | CC(C)(C)OC(=O)n1c(B2OC(C)(C)C(C)(C)O2)cc2cc(F)ccc21.CC(C)OB1OC(C)(C)C(C)(C)O1.Fc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C19H25BFNO4.C9H19BO3.C8H6FN/c1-17(2,3)24-16(23)22-14-9-8-13(21)10-12(14)11-15(22)20-25-18(4,5)19(6,7)26-20;1-7(2)11-10-12-8(3,4)9(5,6)13-10;9-7-1-2-8-6(5-7)3-4-10-8/h8-11H,1-7H3;7H,1-6H3;1-5,10H |
| InChIKey | AUEUTBLGBCIUSH-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.42 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|