C15H22O2 — CID 15723223
[(6E)-5,5-dimethyl-1,2,3,4,8,9-hexahydrocyclopenta[8]annulen-6-yl] acetate (PubChem CID 15723223) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is [(6E)-5,5-dimethyl-1,2,3,4,8,9-hexahydrocyclopenta[8]annulen-6-yl] acetate.
| Compound Name | [(6E)-5,5-dimethyl-1,2,3,4,8,9-hexahydrocyclopenta[8]annulen-6-yl] acetate |
|---|---|
| PubChem CID | 15723223 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | [(6E)-5,5-dimethyl-1,2,3,4,8,9-hexahydrocyclopenta[8]annulen-6-yl] acetate |
| SMILES | CC(=O)O/C1=C/CCC2=C(CCC2)CC1(C)C |
| InChI | InChI=1S/C15H22O2/c1-11(16)17-14-9-5-7-12-6-4-8-13(12)10-15(14,2)3/h9H,4-8,10H2,1-3H3/b14-9+ |
| InChIKey | CISRIJXMRDEOIO-NTEUORMPSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|