C48H28Cl6 — CID 157232417
1,3,5-trichloro-2-[2-[4,5-diphenyl-2-(2,4,6-trichlorophenyl)phenyl]-4,5-diphenylphenyl]benzene (PubChem CID 157232417) has the molecular formula C48H28Cl6 and a molecular weight of 817.47 g/mol. Its IUPAC name is 1,3,5-trichloro-2-[2-[4,5-diphenyl-2-(2,4,6-trichlorophenyl)phenyl]-4,5-diphenylphenyl]benzene.
| Compound Name | 1,3,5-trichloro-2-[2-[4,5-diphenyl-2-(2,4,6-trichlorophenyl)phenyl]-4,5-diphenylphenyl]benzene |
|---|---|
| PubChem CID | 157232417 |
| Molecular Formula | C48H28Cl6 |
| Molecular Weight | 817.47 g/mol |
| Exact Mass | 814.03 |
| IUPAC Name | 1,3,5-trichloro-2-[2-[4,5-diphenyl-2-(2,4,6-trichlorophenyl)phenyl]-4,5-diphenylphenyl]benzene |
| SMILES | Clc1cc(Cl)c(-c2cc(-c3ccccc3)c(-c3ccccc3)cc2-c2cc(-c3ccccc3)c(-c3ccccc3)cc2-c2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C48H28Cl6/c49-33-21-43(51)47(44(52)22-33)41-27-37(31-17-9-3-10-18-31)35(29-13-5-1-6-14-29)25-39(41)40-26-36(30-15-7-2-8-16-30)38(32-19-11-4-12-20-32)28-42(40)48-45(53)23-34(50)24-46(48)54/h1-28H |
| InChIKey | AUGCGJAXQRKAJO-UHFFFAOYSA-N |
| XLogP | 17.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.47 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |