About 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate
2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate (PubChem CID 157232457) has the molecular formula C20H36O6
and a molecular weight of 372.50 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate |
| PubChem CID | 157232457 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate |
| SMILES | C=C(CCCCC)C(=O)OCCO.CCCCCC=CC(=O)OCCO |
| InChI | InChI=1S/2C10H18O3/c1-3-4-5-6-9(2)10(12)13-8-7-11;1-2-3-4-5-6-7-10(12)13-9-8-11/h11H,2-8H2,1H3;6-7,11H,2-5,8-9H2,1H3 |
| InChIKey | AUGFYCKPOCEJLS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate?
The IUPAC name of 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate (CID 157232457) is 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate.
What is the SMILES notation for 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate?
The canonical SMILES for 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate is C=C(CCCCC)C(=O)OCCO.CCCCCC=CC(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate?
The InChIKey is AUGFYCKPOCEJLS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H18O3/c1-3-4-5-6-9(2)10(12)13-8-7-11;1-2-3-4-5-6-7-10(12)13-9-8-11/h11H,2-8H2,1H3;6-7,11H,2-5,8-9H2,1H3.
What are the key properties of 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate?
2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate has a molecular weight of 372.50 g/mol, XLogP of 3.32, 14 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylideneheptanoate;2-hydroxyethyl oct-2-enoate is sourced from PubChem (CID 157232457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).