C24H32BFO3 — CID 157232705
2-[2-fluoro-4-[2-(pentoxymethyl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 157232705) has the molecular formula C24H32BFO3 and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-[2-fluoro-4-[2-(pentoxymethyl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-fluoro-4-[2-(pentoxymethyl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 157232705 |
| Molecular Formula | C24H32BFO3 |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-[2-fluoro-4-[2-(pentoxymethyl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCOCc1ccccc1-c1ccc(B2OC(C)(C)C(C)(C)O2)c(F)c1 |
| InChI | InChI=1S/C24H32BFO3/c1-6-7-10-15-27-17-19-11-8-9-12-20(19)18-13-14-21(22(26)16-18)25-28-23(2,3)24(4,5)29-25/h8-9,11-14,16H,6-7,10,15,17H2,1-5H3 |
| InChIKey | RSDRFHJAHLOICG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|