About (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine
(8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine (PubChem CID 157232786) has the molecular formula C17H19NS
and a molecular weight of 269.41 g/mol. Its IUPAC name is (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine.
Molecular Properties
| Compound Name | (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine |
| PubChem CID | 157232786 |
| Molecular Formula | C17H19NS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine |
| SMILES | c1cc2n(c1)[C@@H](C1CCC3(CC1)CC3)c1sccc1-2 |
| InChI | InChI=1S/C17H19NS/c1-2-14-13-5-11-19-16(13)15(18(14)10-1)12-3-6-17(7-4-12)8-9-17/h1-2,5,10-12,15H,3-4,6-9H2/t15-/m0/s1 |
| InChIKey | VQOPVEMWZFMJJQ-HNNXBMFYSA-N |
| XLogP | 5.09 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine?
The IUPAC name of (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine (CID 157232786) is (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine.
What is the SMILES notation for (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine?
The canonical SMILES for (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine is c1cc2n(c1)[C@@H](C1CCC3(CC1)CC3)c1sccc1-2.
What is the InChIKey of (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine?
The InChIKey is VQOPVEMWZFMJJQ-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H19NS/c1-2-14-13-5-11-19-16(13)15(18(14)10-1)12-3-6-17(7-4-12)8-9-17/h1-2,5,10-12,15H,3-4,6-9H2/t15-/m0/s1.
What are the key properties of (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine?
(8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine has a molecular weight of 269.41 g/mol, XLogP of 5.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8S)-8-spiro[2.5]octan-6-yl-8H-thieno[3,2-a]pyrrolizine is sourced from PubChem (CID 157232786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).