C25H21F3N6O — CID 157233272
[(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(5-pyrazol-1-yl-3-pyridinyl)methanone (PubChem CID 157233272) has the molecular formula C25H21F3N6O and a molecular weight of 478.48 g/mol. Its IUPAC name is [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(5-pyrazol-1-yl-3-pyridinyl)methanone.
| Compound Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(5-pyrazol-1-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 157233272 |
| Molecular Formula | C25H21F3N6O |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | [(1R,8S)-4-methyl-5-(3,4,5-trifluorophenyl)-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(5-pyrazol-1-yl-3-pyridinyl)methanone |
| SMILES | Cn1nc2c(c1-c1cc(F)c(F)c(F)c1)C[C@@H]1CCC[C@H]2N1C(=O)c1cncc(-n2cccn2)c1 |
| InChI | InChI=1S/C25H21F3N6O/c1-32-24(14-9-19(26)22(28)20(27)10-14)18-11-16-4-2-5-21(23(18)31-32)34(16)25(35)15-8-17(13-29-12-15)33-7-3-6-30-33/h3,6-10,12-13,16,21H,2,4-5,11H2,1H3/t16-,21+/m0/s1 |
| InChIKey | AUIQQRPQYBVUAW-HRAATJIYSA-N |
| XLogP | 4.38 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|