C33H26BrFN6O3 — CID 157233434
4-[12-(4-bromo-3-isocyanobenzoyl)-5-[2-(2-fluorophenyl)ethyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 157233434) has the molecular formula C33H26BrFN6O3 and a molecular weight of 653.51 g/mol. Its IUPAC name is 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[2-(2-fluorophenyl)ethyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[2-(2-fluorophenyl)ethyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 157233434 |
| Molecular Formula | C33H26BrFN6O3 |
| Molecular Weight | 653.51 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | 4-[12-(4-bromo-3-isocyanobenzoyl)-5-[2-(2-fluorophenyl)ethyl]-8-oxo-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | [C-]#[N+]c1cc(C(=O)N2CCc3c(n4ncc(CCc5ccccc5F)c4n(-c4ccc(C(=O)NC)cc4)c3=O)C2)ccc1Br |
| InChI | InChI=1S/C33H26BrFN6O3/c1-36-28-17-22(11-14-26(28)34)32(43)39-16-15-25-29(19-39)41-31(23(18-38-41)8-7-20-5-3-4-6-27(20)35)40(33(25)44)24-12-9-21(10-13-24)30(42)37-2/h3-6,9-14,17-18H,7-8,15-16,19H2,2H3,(H,37,42) |
| InChIKey | AUJCKCUPMARURZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|