C13H23F5O2Si — CID 157235981
5-[3-fluoropropyl(dimethyl)silyl]oxy-3-methylpent-1-yn-3-ol;1,1,1,2-tetrafluoroethane (PubChem CID 157235981) has the molecular formula C13H23F5O2Si and a molecular weight of 334.40 g/mol. Its IUPAC name is 5-[3-fluoropropyl(dimethyl)silyl]oxy-3-methylpent-1-yn-3-ol;1,1,1,2-tetrafluoroethane.
| Compound Name | 5-[3-fluoropropyl(dimethyl)silyl]oxy-3-methylpent-1-yn-3-ol;1,1,1,2-tetrafluoroethane |
|---|---|
| PubChem CID | 157235981 |
| Molecular Formula | C13H23F5O2Si |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-[3-fluoropropyl(dimethyl)silyl]oxy-3-methylpent-1-yn-3-ol;1,1,1,2-tetrafluoroethane |
| SMILES | C#CC(C)(O)CCO[Si](C)(C)CCCF.FCC(F)(F)F |
| InChI | InChI=1S/C11H21FO2Si.C2H2F4/c1-5-11(2,13)7-9-14-15(3,4)10-6-8-12;3-1-2(4,5)6/h1,13H,6-10H2,2-4H3;1H2 |
| InChIKey | AUQGSMYHKYRJDC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|