C28H34N10O2 — CID 157237037
1-(1-tert-butyltriazol-4-yl)-2-[(5S)-8-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-2-(oxetan-3-yl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]ethanone (PubChem CID 157237037) has the molecular formula C28H34N10O2 and a molecular weight of 542.65 g/mol. Its IUPAC name is 1-(1-tert-butyltriazol-4-yl)-2-[(5S)-8-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-2-(oxetan-3-yl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]ethanone.
| Compound Name | 1-(1-tert-butyltriazol-4-yl)-2-[(5S)-8-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-2-(oxetan-3-yl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]ethanone |
|---|---|
| PubChem CID | 157237037 |
| Molecular Formula | C28H34N10O2 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | 1-(1-tert-butyltriazol-4-yl)-2-[(5S)-8-[4-[(1-methylpyrazol-4-yl)amino]-1,3,5-triazin-2-yl]-2-(oxetan-3-yl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]ethanone |
| SMILES | Cn1cc(Nc2ncnc(-c3ccc4c(c3)CN(C3COC3)CC[C@H]4CC(=O)c3cn(C(C)(C)C)nn3)n2)cn1 |
| InChI | InChI=1S/C28H34N10O2/c1-28(2,3)38-14-24(34-35-38)25(39)10-18-7-8-37(22-15-40-16-22)12-20-9-19(5-6-23(18)20)26-29-17-30-27(33-26)32-21-11-31-36(4)13-21/h5-6,9,11,13-14,17-18,22H,7-8,10,12,15-16H2,1-4H3,(H,29,30,32,33)/t18-/m0/s1 |
| InChIKey | AUTFSQOMSINOPA-SFHVURJKSA-N |
| XLogP | 3.32 |
| TPSA | 128.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |