About 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile
5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile (PubChem CID 15723746) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile.
Molecular Properties
| Compound Name | 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile |
| PubChem CID | 15723746 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile |
| SMILES | CC12CC3CN(C1)CC(C#N)(C3)C2 |
| InChI | InChI=1S/C11H16N2/c1-10-2-9-3-11(5-10,6-12)8-13(4-9)7-10/h9H,2-5,7-8H2,1H3 |
| InChIKey | DSOPGCNQNGKTPI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile?
The IUPAC name of 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile (CID 15723746) is 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile.
What is the SMILES notation for 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile?
The canonical SMILES for 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile is CC12CC3CN(C1)CC(C#N)(C3)C2.
What is the InChIKey of 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile?
The InChIKey is DSOPGCNQNGKTPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-10-2-9-3-11(5-10,6-12)8-13(4-9)7-10/h9H,2-5,7-8H2,1H3.
What are the key properties of 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile?
5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile has a molecular weight of 176.26 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-azatricyclo[3.3.1.13,7]decane-3-carbonitrile is sourced from PubChem (CID 15723746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).