About 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate
2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate (PubChem CID 15723777) has the molecular formula C16H20N4O4
and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate |
| PubChem CID | 15723777 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)Nc1nc2ccc(C(=O)OCCN3CCCC3)cc2[nH]1 |
| InChI | InChI=1S/C16H20N4O4/c1-23-16(22)19-15-17-12-5-4-11(10-13(12)18-15)14(21)24-9-8-20-6-2-3-7-20/h4-5,10H,2-3,6-9H2,1H3,(H2,17,18,19,22) |
| InChIKey | PSJNURDORLGGEN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate?
The IUPAC name of 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate (CID 15723777) is 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate.
What is the SMILES notation for 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate?
The canonical SMILES for 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate is COC(=O)Nc1nc2ccc(C(=O)OCCN3CCCC3)cc2[nH]1.
What is the InChIKey of 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate?
The InChIKey is PSJNURDORLGGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O4/c1-23-16(22)19-15-17-12-5-4-11(10-13(12)18-15)14(21)24-9-8-20-6-2-3-7-20/h4-5,10H,2-3,6-9H2,1H3,(H2,17,18,19,22).
What are the key properties of 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate?
2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate has a molecular weight of 332.36 g/mol, XLogP of 1.99, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-ylethyl 2-(methoxycarbonylamino)-3H-benzimidazole-5-carboxylate is sourced from PubChem (CID 15723777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).