C14H32Cl4N6O2P2 — CID 157238264
N,1-bis(2-chloroethyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-amine;N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-amine (PubChem CID 157238264) has the molecular formula C14H32Cl4N6O2P2 and a molecular weight of 520.21 g/mol. Its IUPAC name is N,1-bis(2-chloroethyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-amine;N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-amine.
| Compound Name | N,1-bis(2-chloroethyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-amine;N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-amine |
|---|---|
| PubChem CID | 157238264 |
| Molecular Formula | C14H32Cl4N6O2P2 |
| Molecular Weight | 520.21 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | N,1-bis(2-chloroethyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-amine;N,N-bis(2-chloroethyl)-2-oxo-1,3,2λ5-diazaphosphinan-2-amine |
| SMILES | O=P1(N(CCCl)CCCl)NCCCN1.O=P1(NCCCl)NCCCN1CCCl |
| InChI | InChI=1S/2C7H16Cl2N3OP/c8-2-5-11-14(13)10-4-1-6-12(14)7-3-9;8-2-6-12(7-3-9)14(13)10-4-1-5-11-14/h2*1-7H2,(H2,10,11,13) |
| InChIKey | AUXBALLKSLUKMS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|