C49H56N4O6 — CID 157238344
tert-butyl 5-[(3-butoxycarbonyl-5-cyclopropyl-2-pyridinyl)methyl]indole-1-carboxylate;butyl 5-cyclopropyl-2-(1H-indol-5-ylmethyl)pyridine-3-carboxylate (PubChem CID 157238344) has the molecular formula C49H56N4O6 and a molecular weight of 797.01 g/mol. Its IUPAC name is tert-butyl 5-[(3-butoxycarbonyl-5-cyclopropyl-2-pyridinyl)methyl]indole-1-carboxylate;butyl 5-cyclopropyl-2-(1H-indol-5-ylmethyl)pyridine-3-carboxylate.
| Compound Name | tert-butyl 5-[(3-butoxycarbonyl-5-cyclopropyl-2-pyridinyl)methyl]indole-1-carboxylate;butyl 5-cyclopropyl-2-(1H-indol-5-ylmethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 157238344 |
| Molecular Formula | C49H56N4O6 |
| Molecular Weight | 797.01 g/mol |
| Exact Mass | 796.42 |
| IUPAC Name | tert-butyl 5-[(3-butoxycarbonyl-5-cyclopropyl-2-pyridinyl)methyl]indole-1-carboxylate;butyl 5-cyclopropyl-2-(1H-indol-5-ylmethyl)pyridine-3-carboxylate |
| SMILES | CCCCOC(=O)c1cc(C2CC2)cnc1Cc1ccc2[nH]ccc2c1.CCCCOC(=O)c1cc(C2CC2)cnc1Cc1ccc2c(ccn2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H32N2O4.C22H24N2O2/c1-5-6-13-32-25(30)22-16-21(19-8-9-19)17-28-23(22)15-18-7-10-24-20(14-18)11-12-29(24)26(31)33-27(2,3)4;1-2-3-10-26-22(25)19-13-18(16-5-6-16)14-24-21(19)12-15-4-7-20-17(11-15)8-9-23-20/h7,10-12,14,16-17,19H,5-6,8-9,13,15H2,1-4H3;4,7-9,11,13-14,16,23H,2-3,5-6,10,12H2,1H3 |
| InChIKey | AUXIMDSEYWZJHS-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.01 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|