C16H24N3NaO6 — CID 157238733
sodium (2R,3R,4R)-3-methyl-4-[4-(2-methylpropyl)triazol-1-yl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 157238733) has the molecular formula C16H24N3NaO6 and a molecular weight of 377.37 g/mol. Its IUPAC name is sodium (2R,3R,4R)-3-methyl-4-[4-(2-methylpropyl)triazol-1-yl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | sodium (2R,3R,4R)-3-methyl-4-[4-(2-methylpropyl)triazol-1-yl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 157238733 |
| Molecular Formula | C16H24N3NaO6 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | sodium (2R,3R,4R)-3-methyl-4-[4-(2-methylpropyl)triazol-1-yl]-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CC(C)Cc1cn([C@H]2C=C(C(=O)[O-])O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]2C)nn1.[Na+] |
| InChI | InChI=1S/C16H25N3O6.Na/c1-8(2)4-10-6-19(18-17-10)11-5-13(16(23)24)25-15(9(11)3)14(22)12(21)7-20;/h5-6,8-9,11-12,14-15,20-22H,4,7H2,1-3H3,(H,23,24);/q;+1/p-1/t9-,11+,12-,14-,15-;/m1./s1 |
| InChIKey | AUYNFCUZEHASBN-WIGRMGLPSA-M |
| XLogP | -4.60 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |