C22H23F3N4OS — CID 157240234
5-(dimethylamino)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-N-[3-(trifluoromethyl)phenyl]pentanamide (PubChem CID 157240234) has the molecular formula C22H23F3N4OS and a molecular weight of 448.51 g/mol. Its IUPAC name is 5-(dimethylamino)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-N-[3-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 5-(dimethylamino)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-N-[3-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 157240234 |
| Molecular Formula | C22H23F3N4OS |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 5-(dimethylamino)-N-(4-pyridin-3-yl-1,3-thiazol-2-yl)-N-[3-(trifluoromethyl)phenyl]pentanamide |
| SMILES | CN(C)CCCCC(=O)N(c1cccc(C(F)(F)F)c1)c1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C22H23F3N4OS/c1-28(2)12-4-3-10-20(30)29(18-9-5-8-17(13-18)22(23,24)25)21-27-19(15-31-21)16-7-6-11-26-14-16/h5-9,11,13-15H,3-4,10,12H2,1-2H3 |
| InChIKey | AVCVOLOKUWFYFH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|