About 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid
1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid (PubChem CID 157240342) has the molecular formula C6H8N8O4
and a molecular weight of 256.18 g/mol. Its IUPAC name is 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid |
| PubChem CID | 157240342 |
| Molecular Formula | C6H8N8O4 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid |
| SMILES | Cn1nnc(C(=O)O)n1.Cn1nnnc1C(=O)O |
| InChI | InChI=1S/2C3H4N4O2/c1-7-2(3(8)9)4-5-6-7;1-7-5-2(3(8)9)4-6-7/h2*1H3,(H,8,9) |
| InChIKey | AVDDPNUHPPAIAD-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid?
The IUPAC name of 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid (CID 157240342) is 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid.
What is the SMILES notation for 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid?
The canonical SMILES for 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid is Cn1nnc(C(=O)O)n1.Cn1nnnc1C(=O)O.
What is the InChIKey of 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid?
The InChIKey is AVDDPNUHPPAIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H4N4O2/c1-7-2(3(8)9)4-5-6-7;1-7-5-2(3(8)9)4-6-7/h2*1H3,(H,8,9).
What are the key properties of 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid?
1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid has a molecular weight of 256.18 g/mol, XLogP of -2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid is sourced from PubChem (CID 157240342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).