1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid

C6H8N8O4 — CID 157240342

IUPAC1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid
SMILESCn1nnc(C(=O)O)n1.Cn1nnnc1C(=O)O
InChIInChI=1S/2C3H4N4O2/c1-7-2(3(8)9)4-5-6-7;1-7-5-2(3(8)9)4-6-7/h2*1H3,(H,8,9)
InChIKeyAVDDPNUHPPAIAD-UHFFFAOYSA-N
MW256.18 g/mol
LogP-2.18
Rot. Bonds2

About 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid

1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid (PubChem CID 157240342) has the molecular formula C6H8N8O4 and a molecular weight of 256.18 g/mol. Its IUPAC name is 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid.

Molecular Properties

Compound Name1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid
PubChem CID157240342
Molecular FormulaC6H8N8O4
Molecular Weight256.18 g/mol
Exact Mass256.07
IUPAC Name1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid
SMILESCn1nnc(C(=O)O)n1.Cn1nnnc1C(=O)O
InChIInChI=1S/2C3H4N4O2/c1-7-2(3(8)9)4-5-6-7;1-7-5-2(3(8)9)4-6-7/h2*1H3,(H,8,9)
InChIKeyAVDDPNUHPPAIAD-UHFFFAOYSA-N
XLogP-2.18
TPSA161.80 Ų
H-Bond Donors2
H-Bond Acceptors10
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.18
LogP ≤ 5-2.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 1010

Analyze 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid?
The IUPAC name of 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid (CID 157240342) is 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid.
What is the SMILES notation for 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid?
The canonical SMILES for 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid is Cn1nnc(C(=O)O)n1.Cn1nnnc1C(=O)O.
What is the InChIKey of 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid?
The InChIKey is AVDDPNUHPPAIAD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H4N4O2/c1-7-2(3(8)9)4-5-6-7;1-7-5-2(3(8)9)4-6-7/h2*1H3,(H,8,9).
What are the key properties of 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid?
1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid has a molecular weight of 256.18 g/mol, XLogP of -2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyltetrazole-5-carboxylic acid;2-methyltetrazole-5-carboxylic acid is sourced from PubChem (CID 157240342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).