About 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one
4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one (PubChem CID 15724065) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one |
| PubChem CID | 15724065 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one |
| SMILES | CC1=NOC(=O)C1(N)C(C)C |
| InChI | InChI=1S/C7H12N2O2/c1-4(2)7(8)5(3)9-11-6(7)10/h4H,8H2,1-3H3 |
| InChIKey | SGMMRCXRWUSVEX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one?
The IUPAC name of 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one (CID 15724065) is 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one.
What is the SMILES notation for 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one?
The canonical SMILES for 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one is CC1=NOC(=O)C1(N)C(C)C.
What is the InChIKey of 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one?
The InChIKey is SGMMRCXRWUSVEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-4(2)7(8)5(3)9-11-6(7)10/h4H,8H2,1-3H3.
What are the key properties of 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one?
4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one has a molecular weight of 156.18 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-methyl-4-propan-2-yl-1,2-oxazol-5-one is sourced from PubChem (CID 15724065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).