About N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide
N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide (PubChem CID 15724068) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide |
| PubChem CID | 15724068 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide |
| SMILES | CCC1(/N=C/N(C)C)C(=O)ON=C1c1ccccc1 |
| InChI | InChI=1S/C14H17N3O2/c1-4-14(15-10-17(2)3)12(16-19-13(14)18)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3/b15-10+ |
| InChIKey | GIHCIXGUXBWMIX-XNTDXEJSSA-N |
| XLogP | 1.69 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide?
The IUPAC name of N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide (CID 15724068) is N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide is CCC1(/N=C/N(C)C)C(=O)ON=C1c1ccccc1.
What is the InChIKey of N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide?
The InChIKey is GIHCIXGUXBWMIX-XNTDXEJSSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-4-14(15-10-17(2)3)12(16-19-13(14)18)11-8-6-5-7-9-11/h5-10H,4H2,1-3H3/b15-10+.
What are the key properties of N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide?
N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide has a molecular weight of 259.31 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-ethyl-5-oxo-3-phenyl-1,2-oxazol-4-yl)-N,N-dimethylmethanimidamide is sourced from PubChem (CID 15724068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).