C18H17F2N3O3S — CID 157240733
N-(3,4-difluorophenyl)-5-[[(3S)-oxolan-3-yl]methylsulfonyl]-1H-indazol-3-amine (PubChem CID 157240733) has the molecular formula C18H17F2N3O3S and a molecular weight of 393.42 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-[[(3S)-oxolan-3-yl]methylsulfonyl]-1H-indazol-3-amine.
| Compound Name | N-(3,4-difluorophenyl)-5-[[(3S)-oxolan-3-yl]methylsulfonyl]-1H-indazol-3-amine |
|---|---|
| PubChem CID | 157240733 |
| Molecular Formula | C18H17F2N3O3S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-[[(3S)-oxolan-3-yl]methylsulfonyl]-1H-indazol-3-amine |
| SMILES | O=S(=O)(C[C@H]1CCOC1)c1ccc2[nH]nc(Nc3ccc(F)c(F)c3)c2c1 |
| InChI | InChI=1S/C18H17F2N3O3S/c19-15-3-1-12(7-16(15)20)21-18-14-8-13(2-4-17(14)22-23-18)27(24,25)10-11-5-6-26-9-11/h1-4,7-8,11H,5-6,9-10H2,(H2,21,22,23)/t11-/m0/s1 |
| InChIKey | SXOBEGVXPDDTTH-NSHDSACASA-N |
| XLogP | 3.39 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |