C21H16F5NO2S — CID 157242068
2-[(4aS,5S,7aS)-7a-(2,3-difluorophenyl)-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 157242068) has the molecular formula C21H16F5NO2S and a molecular weight of 441.42 g/mol. Its IUPAC name is 2-[(4aS,5S,7aS)-7a-(2,3-difluorophenyl)-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aS,5S,7aS)-7a-(2,3-difluorophenyl)-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 157242068 |
| Molecular Formula | C21H16F5NO2S |
| Molecular Weight | 441.42 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2-[(4aS,5S,7aS)-7a-(2,3-difluorophenyl)-5-(trifluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | O=C(CC1=N[C@@]2(c3cccc(F)c3F)CO[C@H](C(F)(F)F)[C@H]2CS1)c1ccccc1 |
| InChI | InChI=1S/C21H16F5NO2S/c22-15-8-4-7-13(18(15)23)20-11-29-19(21(24,25)26)14(20)10-30-17(27-20)9-16(28)12-5-2-1-3-6-12/h1-8,14,19H,9-11H2/t14-,19+,20-/m1/s1 |
| InChIKey | LEUZTLDINTWTQC-VOBQZIQPSA-N |
| XLogP | 5.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |