C21H40O2Si — CID 157242268
(2E,4R,5S,6E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-3,7-dimethylundeca-2,6,10-trien-4-ol (PubChem CID 157242268) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is (2E,4R,5S,6E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-3,7-dimethylundeca-2,6,10-trien-4-ol.
| Compound Name | (2E,4R,5S,6E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-3,7-dimethylundeca-2,6,10-trien-4-ol |
|---|---|
| PubChem CID | 157242268 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | (2E,4R,5S,6E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-5-ethyl-3,7-dimethylundeca-2,6,10-trien-4-ol |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/[C@H](CC)[C@@H](O)/C(C)=C/C |
| InChI | InChI=1S/C21H40O2Si/c1-11-14-19(23-24(9,10)21(6,7)8)17(5)15-18(13-3)20(22)16(4)12-2/h11-12,15,18-20,22H,1,13-14H2,2-10H3/b16-12+,17-15+/t18-,19-,20-/m0/s1 |
| InChIKey | AVIRNEWSKKDPAP-PXMBDRLNSA-N |
| XLogP | 6.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|