C26H24F3N3O3S — CID 157242371
trifluoromethanesulfonate;trimethyl-[[4-methyl-3,5-bis(2-pyridin-4-ylethynyl)phenyl]methyl]azanium (PubChem CID 157242371) has the molecular formula C26H24F3N3O3S and a molecular weight of 515.56 g/mol. Its IUPAC name is trifluoromethanesulfonate;trimethyl-[[4-methyl-3,5-bis(2-pyridin-4-ylethynyl)phenyl]methyl]azanium.
| Compound Name | trifluoromethanesulfonate;trimethyl-[[4-methyl-3,5-bis(2-pyridin-4-ylethynyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 157242371 |
| Molecular Formula | C26H24F3N3O3S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | trifluoromethanesulfonate;trimethyl-[[4-methyl-3,5-bis(2-pyridin-4-ylethynyl)phenyl]methyl]azanium |
| SMILES | Cc1c(C#Cc2ccncc2)cc(C[N+](C)(C)C)cc1C#Cc1ccncc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C25H24N3.CHF3O3S/c1-20-24(7-5-21-9-13-26-14-10-21)17-23(19-28(2,3)4)18-25(20)8-6-22-11-15-27-16-12-22;2-1(3,4)8(5,6)7/h9-18H,19H2,1-4H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | AVIYPVVAMXVMIF-UHFFFAOYSA-M |
| XLogP | 3.84 |
| TPSA | 82.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|