C29H25FN4O4 — CID 157242955
4-(1,2-benzoxazol-3-yl)-5-[6-fluoro-10-(piperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]cyclopent-4-ene-1,3-dione (PubChem CID 157242955) has the molecular formula C29H25FN4O4 and a molecular weight of 512.54 g/mol. Its IUPAC name is 4-(1,2-benzoxazol-3-yl)-5-[6-fluoro-10-(piperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]cyclopent-4-ene-1,3-dione.
| Compound Name | 4-(1,2-benzoxazol-3-yl)-5-[6-fluoro-10-(piperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]cyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 157242955 |
| Molecular Formula | C29H25FN4O4 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-(1,2-benzoxazol-3-yl)-5-[6-fluoro-10-(piperidine-1-carbonyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]cyclopent-4-ene-1,3-dione |
| SMILES | O=C1CC(=O)C(c2cn3c4c(cc(F)cc24)CN(C(=O)N2CCCCC2)CC3)=C1c1noc2ccccc12 |
| InChI | InChI=1S/C29H25FN4O4/c30-18-12-17-15-34(29(37)32-8-4-1-5-9-32)11-10-33-16-21(20(13-18)28(17)33)25-22(35)14-23(36)26(25)27-19-6-2-3-7-24(19)38-31-27/h2-3,6-7,12-13,16H,1,4-5,8-11,14-15H2 |
| InChIKey | SLQKWFQHJHVNPI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|