C29H26Br2ClF2N3O2 — CID 157243173
1-[(2-amino-4-chloro-3-fluorophenyl)methyl]-7-bromo-2-methylquinolin-4-one;(E)-1-(4-bromo-2-fluorophenyl)-3-(dimethylamino)but-2-en-1-one (PubChem CID 157243173) has the molecular formula C29H26Br2ClF2N3O2 and a molecular weight of 681.80 g/mol. Its IUPAC name is 1-[(2-amino-4-chloro-3-fluorophenyl)methyl]-7-bromo-2-methylquinolin-4-one;(E)-1-(4-bromo-2-fluorophenyl)-3-(dimethylamino)but-2-en-1-one.
| Compound Name | 1-[(2-amino-4-chloro-3-fluorophenyl)methyl]-7-bromo-2-methylquinolin-4-one;(E)-1-(4-bromo-2-fluorophenyl)-3-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 157243173 |
| Molecular Formula | C29H26Br2ClF2N3O2 |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 679.00 |
| IUPAC Name | 1-[(2-amino-4-chloro-3-fluorophenyl)methyl]-7-bromo-2-methylquinolin-4-one;(E)-1-(4-bromo-2-fluorophenyl)-3-(dimethylamino)but-2-en-1-one |
| SMILES | C/C(=C\C(=O)c1ccc(Br)cc1F)N(C)C.Cc1cc(=O)c2ccc(Br)cc2n1Cc1ccc(Cl)c(F)c1N |
| InChI | InChI=1S/C17H13BrClFN2O.C12H13BrFNO/c1-9-6-15(23)12-4-3-11(18)7-14(12)22(9)8-10-2-5-13(19)16(20)17(10)21;1-8(15(2)3)6-12(16)10-5-4-9(13)7-11(10)14/h2-7H,8,21H2,1H3;4-7H,1-3H3/b;8-6+ |
| InChIKey | AVLDIBCFFXYIMX-ZQGZPJDTSA-N |
| XLogP | 7.73 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|