C44H66Br2N4Sn2 — CID 157243315
2-bromo-6-(6-bromo-2-pyridinyl)pyridine;tributyl-[6-(6-tributylstannyl-2-pyridinyl)-2-pyridinyl]stannane (PubChem CID 157243315) has the molecular formula C44H66Br2N4Sn2 and a molecular weight of 1048.27 g/mol. Its IUPAC name is 2-bromo-6-(6-bromo-2-pyridinyl)pyridine;tributyl-[6-(6-tributylstannyl-2-pyridinyl)-2-pyridinyl]stannane.
| Compound Name | 2-bromo-6-(6-bromo-2-pyridinyl)pyridine;tributyl-[6-(6-tributylstannyl-2-pyridinyl)-2-pyridinyl]stannane |
|---|---|
| PubChem CID | 157243315 |
| Molecular Formula | C44H66Br2N4Sn2 |
| Molecular Weight | 1048.27 g/mol |
| Exact Mass | 1048.17 |
| IUPAC Name | 2-bromo-6-(6-bromo-2-pyridinyl)pyridine;tributyl-[6-(6-tributylstannyl-2-pyridinyl)-2-pyridinyl]stannane |
| SMILES | Brc1cccc(-c2cccc(Br)n2)n1.CCCC[Sn](CCCC)(CCCC)c1cccc(-c2cccc([Sn](CCCC)(CCCC)CCCC)n2)n1 |
| InChI | InChI=1S/C10H6Br2N2.C10H6N2.6C4H9.2Sn/c11-9-5-1-3-7(13-9)8-4-2-6-10(12)14-8;1-3-7-11-9(5-1)10-6-2-4-8-12-10;6*1-3-4-2;;/h1-6H;1-6H;6*1,3-4H2,2H3;; |
| InChIKey | AVLQPBYJDRQAQY-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.27 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|