C24H34N4O2 — CID 15724475
1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-methylpyrrol-2-yl]methyl]azepan-2-one (PubChem CID 15724475) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-methylpyrrol-2-yl]methyl]azepan-2-one.
| Compound Name | 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-methylpyrrol-2-yl]methyl]azepan-2-one |
|---|---|
| PubChem CID | 15724475 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 1-[[5-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-1-methylpyrrol-2-yl]methyl]azepan-2-one |
| SMILES | COc1ccccc1N1CCN(Cc2ccc(CN3CCCCCC3=O)n2C)CC1 |
| InChI | InChI=1S/C24H34N4O2/c1-25-20(11-12-21(25)19-28-13-7-3-4-10-24(28)29)18-26-14-16-27(17-15-26)22-8-5-6-9-23(22)30-2/h5-6,8-9,11-12H,3-4,7,10,13-19H2,1-2H3 |
| InChIKey | JZPBMEODQISYNB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |