About 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane
3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane (PubChem CID 157245131) has the molecular formula C11H21NOSi
and a molecular weight of 211.38 g/mol. Its IUPAC name is 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane.
Molecular Properties
| Compound Name | 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane |
| PubChem CID | 157245131 |
| Molecular Formula | C11H21NOSi |
| Molecular Weight | 211.38 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane |
| SMILES | C[SiH](C)C.N#CC=CC1(O)CCCC1 |
| InChI | InChI=1S/C8H11NO.C3H10Si/c9-7-3-6-8(10)4-1-2-5-8;1-4(2)3/h3,6,10H,1-2,4-5H2;4H,1-3H3 |
| InChIKey | AVRBPRHPNQACAM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane?
The IUPAC name of 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane (CID 157245131) is 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane.
What is the SMILES notation for 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane?
The canonical SMILES for 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane is C[SiH](C)C.N#CC=CC1(O)CCCC1.
What is the InChIKey of 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane?
The InChIKey is AVRBPRHPNQACAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C3H10Si/c9-7-3-6-8(10)4-1-2-5-8;1-4(2)3/h3,6,10H,1-2,4-5H2;4H,1-3H3.
What are the key properties of 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane?
3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane has a molecular weight of 211.38 g/mol, XLogP of 2.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hydroxycyclopentyl)prop-2-enenitrile;trimethylsilane is sourced from PubChem (CID 157245131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).