About 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate
3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate (PubChem CID 157245347) has the molecular formula C18H11IN6O2
and a molecular weight of 470.23 g/mol. Its IUPAC name is 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate.
Molecular Properties
| Compound Name | 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate |
| PubChem CID | 157245347 |
| Molecular Formula | C18H11IN6O2 |
| Molecular Weight | 470.23 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate |
| SMILES | [C-]#[N+]c1ccc2c(C(=O)OC)n[nH]c2c1.[C-]#[N+]c1ccc2c(I)[nH]nc2c1 |
| InChI | InChI=1S/C10H7N3O2.C8H4IN3/c1-11-6-3-4-7-8(5-6)12-13-9(7)10(14)15-2;1-10-5-2-3-6-7(4-5)11-12-8(6)9/h3-5H,2H3,(H,12,13);2-4H,(H,11,12) |
| InChIKey | AVRRPWLDDOBZKJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate?
The IUPAC name of 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate (CID 157245347) is 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate.
What is the SMILES notation for 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate?
The canonical SMILES for 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate is [C-]#[N+]c1ccc2c(C(=O)OC)n[nH]c2c1.[C-]#[N+]c1ccc2c(I)[nH]nc2c1.
What is the InChIKey of 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate?
The InChIKey is AVRRPWLDDOBZKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O2.C8H4IN3/c1-11-6-3-4-7-8(5-6)12-13-9(7)10(14)15-2;1-10-5-2-3-6-7(4-5)11-12-8(6)9/h3-5H,2H3,(H,12,13);2-4H,(H,11,12).
What are the key properties of 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate?
3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate has a molecular weight of 470.23 g/mol, XLogP of 4.62, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-6-isocyano-2H-indazole;methyl 6-isocyano-1H-indazole-3-carboxylate is sourced from PubChem (CID 157245347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).