About 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide
2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide (PubChem CID 15724585) has the molecular formula C15H23IN2O3S
and a molecular weight of 438.33 g/mol. Its IUPAC name is 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide.
Molecular Properties
| Compound Name | 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide |
| PubChem CID | 15724585 |
| Molecular Formula | C15H23IN2O3S |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide |
| SMILES | CCSCCOC(=O)N(Cc1cccc[n+]1CC)C(C)=O.[I-] |
| InChI | InChI=1S/C15H23N2O3S.HI/c1-4-16-9-7-6-8-14(16)12-17(13(3)18)15(19)20-10-11-21-5-2;/h6-9H,4-5,10-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | QEKSKTHIUVEOQW-UHFFFAOYSA-M |
| XLogP | -0.76 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide?
The IUPAC name of 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide (CID 15724585) is 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide.
What is the SMILES notation for 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide?
The canonical SMILES for 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide is CCSCCOC(=O)N(Cc1cccc[n+]1CC)C(C)=O.[I-].
What is the InChIKey of 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide?
The InChIKey is QEKSKTHIUVEOQW-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H23N2O3S.HI/c1-4-16-9-7-6-8-14(16)12-17(13(3)18)15(19)20-10-11-21-5-2;/h6-9H,4-5,10-12H2,1-3H3;1H/q+1;/p-1.
What are the key properties of 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide?
2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide has a molecular weight of 438.33 g/mol, XLogP of -0.76, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanylethyl N-acetyl-N-[(1-ethylpyridin-1-ium-2-yl)methyl]carbamate iodide is sourced from PubChem (CID 15724585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).