About ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine
ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine (PubChem CID 157245911) has the molecular formula C10H13I2NO3S
and a molecular weight of 481.09 g/mol. Its IUPAC name is ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine.
Molecular Properties
| Compound Name | ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine |
| PubChem CID | 157245911 |
| Molecular Formula | C10H13I2NO3S |
| Molecular Weight | 481.09 g/mol |
| Exact Mass | 480.87 |
| IUPAC Name | ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine |
| SMILES | CC.Cc1ccccc1S(=O)(=O)N=C=O.II |
| InChI | InChI=1S/C8H7NO3S.C2H6.I2/c1-7-4-2-3-5-8(7)13(11,12)9-6-10;2*1-2/h2-5H,1H3;1-2H3; |
| InChIKey | AVTLUNTZCGGKSJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine?
The IUPAC name of ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine (CID 157245911) is ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine.
What is the SMILES notation for ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine?
The canonical SMILES for ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine is CC.Cc1ccccc1S(=O)(=O)N=C=O.II.
What is the InChIKey of ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine?
The InChIKey is AVTLUNTZCGGKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3S.C2H6.I2/c1-7-4-2-3-5-8(7)13(11,12)9-6-10;2*1-2/h2-5H,1H3;1-2H3;.
What are the key properties of ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine?
ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine has a molecular weight of 481.09 g/mol, XLogP of 3.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-N-(oxomethylidene)benzenesulfonamide;molecular iodine is sourced from PubChem (CID 157245911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).