C30H32Cl2N10O5 — CID 157246364
8-amino-7,10-dimethylbenzo[g]pteridine-2,4-dione;8-[bis(2-chloroethyl)amino]-7,10-dimethylbenzo[g]pteridine-2,4-dione;oxirane (PubChem CID 157246364) has the molecular formula C30H32Cl2N10O5 and a molecular weight of 683.56 g/mol. Its IUPAC name is 8-amino-7,10-dimethylbenzo[g]pteridine-2,4-dione;8-[bis(2-chloroethyl)amino]-7,10-dimethylbenzo[g]pteridine-2,4-dione;oxirane.
| Compound Name | 8-amino-7,10-dimethylbenzo[g]pteridine-2,4-dione;8-[bis(2-chloroethyl)amino]-7,10-dimethylbenzo[g]pteridine-2,4-dione;oxirane |
|---|---|
| PubChem CID | 157246364 |
| Molecular Formula | C30H32Cl2N10O5 |
| Molecular Weight | 683.56 g/mol |
| Exact Mass | 682.19 |
| IUPAC Name | 8-amino-7,10-dimethylbenzo[g]pteridine-2,4-dione;8-[bis(2-chloroethyl)amino]-7,10-dimethylbenzo[g]pteridine-2,4-dione;oxirane |
| SMILES | C1CO1.Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C)c2cc1N.Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(C)c2cc1N(CCCl)CCCl |
| InChI | InChI=1S/C16H17Cl2N5O2.C12H11N5O2.C2H4O/c1-9-7-10-12(8-11(9)23(5-3-17)6-4-18)22(2)14-13(19-10)15(24)21-16(25)20-14;1-5-3-7-8(4-6(5)13)17(2)10-9(14-7)11(18)16-12(19)15-10;1-2-3-1/h7-8H,3-6H2,1-2H3,(H,21,24,25);3-4H,13H2,1-2H3,(H,16,18,19);1-2H2 |
| InChIKey | AVUWUFAOHBXQQA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 203.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.56 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|