C18H32F2O2Si — CID 15724662
(3aS,5R,6R,6aR)-6-butyl-5-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-1,3a,4,5,6,6a-hexahydropentalen-2-one (PubChem CID 15724662) has the molecular formula C18H32F2O2Si and a molecular weight of 346.53 g/mol. Its IUPAC name is (3aS,5R,6R,6aR)-6-butyl-5-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-1,3a,4,5,6,6a-hexahydropentalen-2-one.
| Compound Name | (3aS,5R,6R,6aR)-6-butyl-5-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-1,3a,4,5,6,6a-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 15724662 |
| Molecular Formula | C18H32F2O2Si |
| Molecular Weight | 346.53 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (3aS,5R,6R,6aR)-6-butyl-5-[tert-butyl(dimethyl)silyl]oxy-3,3-difluoro-1,3a,4,5,6,6a-hexahydropentalen-2-one |
| SMILES | CCCC[C@@H]1[C@H]2CC(=O)C(F)(F)[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32F2O2Si/c1-7-8-9-12-13-10-16(21)18(19,20)14(13)11-15(12)22-23(5,6)17(2,3)4/h12-15H,7-11H2,1-6H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | JNTBQHKRJGJQES-APIJFGDWSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|