About 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one
2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one (PubChem CID 15724698) has the molecular formula C26H32O2
and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one.
Molecular Properties
| Compound Name | 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one |
| PubChem CID | 15724698 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one |
| SMILES | CC(C)C(=O)c1ccc(C2(C)CC(C)(C)c3cc(C(=O)C(C)C)ccc32)cc1 |
| InChI | InChI=1S/C26H32O2/c1-16(2)23(27)18-8-11-20(12-9-18)26(7)15-25(5,6)22-14-19(10-13-21(22)26)24(28)17(3)4/h8-14,16-17H,15H2,1-7H3 |
| InChIKey | AVGNRXDPYQPFIQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one?
The IUPAC name of 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one (CID 15724698) is 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one.
What is the SMILES notation for 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one?
The canonical SMILES for 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one is CC(C)C(=O)c1ccc(C2(C)CC(C)(C)c3cc(C(=O)C(C)C)ccc32)cc1.
What is the InChIKey of 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one?
The InChIKey is AVGNRXDPYQPFIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32O2/c1-16(2)23(27)18-8-11-20(12-9-18)26(7)15-25(5,6)22-14-19(10-13-21(22)26)24(28)17(3)4/h8-14,16-17H,15H2,1-7H3.
What are the key properties of 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one?
2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one has a molecular weight of 376.54 g/mol, XLogP of 6.35, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[4-[1,3,3-trimethyl-5-(2-methylpropanoyl)-2H-inden-1-yl]phenyl]propan-1-one is sourced from PubChem (CID 15724698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).