C31H38N2O2 — CID 157247611
(5'aR,6'R,9'aR)-3'-benzyl-6',9'a-dimethyl-2'-(4-propan-2-ylphenyl)spiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole] (PubChem CID 157247611) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is (5'aR,6'R,9'aR)-3'-benzyl-6',9'a-dimethyl-2'-(4-propan-2-ylphenyl)spiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole].
| Compound Name | (5'aR,6'R,9'aR)-3'-benzyl-6',9'a-dimethyl-2'-(4-propan-2-ylphenyl)spiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole] |
|---|---|
| PubChem CID | 157247611 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (5'aR,6'R,9'aR)-3'-benzyl-6',9'a-dimethyl-2'-(4-propan-2-ylphenyl)spiro[1,3-dioxolane-2,7'-4,5,5a,6,8,9-hexahydrobenzo[e]benzimidazole] |
| SMILES | CC(C)c1ccc(-c2nc3c(n2Cc2ccccc2)CC[C@@H]2[C@@H](C)C4(CC[C@@]32C)OCCO4)cc1 |
| InChI | InChI=1S/C31H38N2O2/c1-21(2)24-10-12-25(13-11-24)29-32-28-27(33(29)20-23-8-6-5-7-9-23)15-14-26-22(3)31(34-18-19-35-31)17-16-30(26,28)4/h5-13,21-22,26H,14-20H2,1-4H3/t22-,26-,30-/m1/s1 |
| InChIKey | ZVOOSYFRVAGQTR-BCAKYAHRSA-N |
| XLogP | 6.71 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |