C11H13F6NO4 — CID 15724801
2-(2,2,3,4,4,4-hexafluorobutoxycarbonylamino)ethyl 2-methylprop-2-enoate (PubChem CID 15724801) has the molecular formula C11H13F6NO4 and a molecular weight of 337.22 g/mol. Its IUPAC name is 2-(2,2,3,4,4,4-hexafluorobutoxycarbonylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(2,2,3,4,4,4-hexafluorobutoxycarbonylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 15724801 |
| Molecular Formula | C11H13F6NO4 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(2,2,3,4,4,4-hexafluorobutoxycarbonylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H13F6NO4/c1-6(2)7(19)21-4-3-18-9(20)22-5-10(13,14)8(12)11(15,16)17/h8H,1,3-5H2,2H3,(H,18,20) |
| InChIKey | MBSJTWIJLCSWTD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|